819850-16-3 Usage
General Description
2-Pyrimidin-2-yl-propanoic acid, also known as pyrimidinylpropionic acid, is a chemical compound with the molecular formula C8H8N2O2. It belongs to the class of pyrimidine compounds and contains a propionic acid group. 2-PYRIMIDIN-2-YL-PROPIONIC ACID has potential applications in the pharmaceutical and agrochemical industries, where it can be used as a building block for the synthesis of various biologically active molecules. Its properties and reactivity make it a valuable intermediate in the development of new drugs and agricultural chemicals. Additionally, its structural features may allow it to exhibit biological activities and interactions with various cellular targets, making it a subject of interest for further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 819850-16-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,1,9,8,5 and 0 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 819850-16:
(8*8)+(7*1)+(6*9)+(5*8)+(4*5)+(3*0)+(2*1)+(1*6)=193
193 % 10 = 3
So 819850-16-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O2/c1-5(7(10)11)6-8-3-2-4-9-6/h2-5H,1H3,(H,10,11)
