82040-80-0 Usage
General Description
2,6-dibromo-4-(2-nitroethenyl)phenol, also known as 2,6-dibromo-4-(2-nitrovinyl)phenol, is a chemical compound with the molecular formula C8H5Br2NO4. It is a halogenated phenolic compound that contains two bromine atoms and a nitro group. This chemical is often used as a fungicide and bactericide in agricultural and industrial applications. It is also known for its anti-microbial and anti-fungal properties, making it a common ingredient in various personal care and healthcare products. Additionally, it has been studied for its potential pharmaceutical applications due to its biological activity against certain types of bacteria and fungi. However,
Check Digit Verification of cas no
The CAS Registry Mumber 82040-80-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,0,4 and 0 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 82040-80:
(7*8)+(6*2)+(5*0)+(4*4)+(3*0)+(2*8)+(1*0)=100
100 % 10 = 0
So 82040-80-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H5Br2NO3/c9-6-3-5(1-2-11(13)14)4-7(10)8(6)12/h1-4,12H