823217-70-5 Usage
General Description
1H-Pyrrolo[2,3-b]pyridine-2-carboxylic acid, 5-methyl-, ethyl ester (9CI) is a chemical compound with a complex molecular structure that includes a pyrrolopyridine ring and a carboxylic acid group. It is commonly used in the pharmaceutical industry as a building block for the synthesis of various drug molecules, particularly those targeting neurological disorders and cancer. The ethyl ester group makes it a suitable candidate for drug delivery, as it can be easily converted into its active form in the body. Additionally, the presence of the methyl group on the pyrrolopyridine ring can affect the compound's pharmacological properties, making it a potentially valuable molecule for drug development and research.
Check Digit Verification of cas no
The CAS Registry Mumber 823217-70-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,2,3,2,1 and 7 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 823217-70:
(8*8)+(7*2)+(6*3)+(5*2)+(4*1)+(3*7)+(2*7)+(1*0)=145
145 % 10 = 5
So 823217-70-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H12N2O2/c1-3-15-11(14)9-5-8-4-7(2)6-12-10(8)13-9/h4-6H,3H2,1-2H3,(H,12,13)