82457-10-1 Usage
Chemical structure
Fused benzimidazole and isoquinoline ring system
Functional group
Methoxymethyl group attached to the benzimidazole ring at the 3-carbon position
Importance
Potential pharmaceutical applications in medicinal chemistry
Potential uses
Further research and experimentation needed to determine specific properties and applications
Check Digit Verification of cas no
The CAS Registry Mumber 82457-10-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,4,5 and 7 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 82457-10:
(7*8)+(6*2)+(5*4)+(4*5)+(3*7)+(2*1)+(1*0)=131
131 % 10 = 1
So 82457-10-1 is a valid CAS Registry Number.
InChI:InChI=1/C20H14N2O2/c1-24-11-12-9-10-14-18-13(12)5-4-6-15(18)20(23)22-17-8-3-2-7-16(17)21-19(14)22/h2-10H,11H2,1H3