82532-83-0 Usage
Chemical structure
Contains a five-membered oxazolidinedione ring, a dichlorophenyl group, a methyl group, and an oxiranyl (epoxy) group.
Type of compound
2,4-Oxazolidinedione, 3-(3,5-dichlorophenyl)-5-methyl-5-oxiranylis a chemical compound.
Application
Used in the field of chemistry and pharmaceuticals.
Purpose
Serves as a building block in the synthesis of various organic compounds.
Potential
May have applications in the development of new drugs or materials.
Requirement
Further research and testing are needed to fully understand its potential uses and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 82532-83-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,5,3 and 2 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 82532-83:
(7*8)+(6*2)+(5*5)+(4*3)+(3*2)+(2*8)+(1*3)=130
130 % 10 = 0
So 82532-83-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H9Cl2NO4/c1-12(9-5-18-9)10(16)15(11(17)19-12)8-3-6(13)2-7(14)4-8/h2-4,9H,5H2,1H3