82560-69-8 Usage
General Description
The chemical "(2,2-dimethyl-3H-benzofuran-7-yl) N-(cyanomethyl-phenyl-amino)sulfanyl -N-methyl-carbamate" is a complex compound that contains a benzofuran-7-yl group, a cyanomethyl-phenyl-amino sulfanyl group, and a N-methyl-carbamate group. The compound is a combination of a benzofuran derivative and a carbamate derivative, making it a potentially valuable chemical for pharmaceutical or agricultural applications. The presence of the cyanomethyl-phenyl-amino sulfanyl group suggests that the compound may have some functionality related to sulfur-containing organic compounds. Overall, the complex structure of this chemical suggests that it may have diverse applications and potential biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 82560-69-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,5,6 and 0 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 82560-69:
(7*8)+(6*2)+(5*5)+(4*6)+(3*0)+(2*6)+(1*9)=138
138 % 10 = 8
So 82560-69-8 is a valid CAS Registry Number.
InChI:InChI=1/C20H21N3O3S/c1-20(2)14-15-8-7-11-17(18(15)26-20)25-19(24)22(3)27-23(13-12-21)16-9-5-4-6-10-16/h4-11H,13-14H2,1-3H3