82576-52-1 Usage
General Description
Bendazaclysine is a research chemical that is still in the early stages of study. It is a hybrid molecule that combines the properties of bendazac and lysine, two separate compounds with potential therapeutic effects. Bendazac is an anti-inflammatory and anti-allergic drug, while lysine is an essential amino acid with various physiological roles. Bendazaclysine is believed to have anti-inflammatory, anti-allergic, and potentially antitumor properties, making it a promising candidate for the development of new drugs for various medical conditions. However, further research and clinical trials are needed to determine its safety, efficacy, and potential applications in medical practice.
Check Digit Verification of cas no
The CAS Registry Mumber 82576-52-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,5,7 and 6 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 82576-52:
(7*8)+(6*2)+(5*5)+(4*7)+(3*6)+(2*5)+(1*2)=151
151 % 10 = 1
So 82576-52-1 is a valid CAS Registry Number.
InChI:InChI=1/C16H14N2O3.C6H14N2O2/c19-15(20)11-21-16-13-8-4-5-9-14(13)18(17-16)10-12-6-2-1-3-7-12;7-4-2-1-3-5(8)6(9)10/h1-9H,10-11H2,(H,19,20);5H,1-4,7-8H2,(H,9,10)