82771-59-3 Usage
General Description
1-(1,2,3,4-Tetrahydroisoquinolin-7-yl)ethanone is a chemical compound with the molecular formula C11H13NO. It is a cyclic ketone with a 1,2,3,4-tetrahydroisoquinoline group attached to an ethanone moiety. 1-(1,2,3,4-TETRAHYDROISOQUINOLIN-7-YL)ETHANONE is used in organic synthesis and pharmaceutical research as a building block for the creation of various biologically active molecules. It may also have potential applications in medicinal chemistry due to its structural features and potential pharmacological properties. However, further research is needed to fully understand the potential uses and effects of 1-(1,2,3,4-Tetrahydroisoquinolin-7-yl)ethanone in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 82771-59-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,7,7 and 1 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 82771-59:
(7*8)+(6*2)+(5*7)+(4*7)+(3*1)+(2*5)+(1*9)=153
153 % 10 = 3
So 82771-59-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H13NO/c1-8(13)10-3-2-9-4-5-12-7-11(9)6-10/h2-3,6,12H,4-5,7H2,1H3