82846-39-7 Usage
General Description
The chemical "(E)-1-(5-bromo-2,4-dihydroxy-phenyl)-3-(3,5-dibromo-2-hydroxy-phenyl)prop-2-en-1-one" is a compound with a complex molecular structure. It contains two bromine atoms and two hydroxyphenyl groups, as well as a prop-2-en-1-one functional group. The compound has a trans configuration with a double bond in the prop-2-en-1-one moiety. It may have potential applications in various fields, such as pharmaceuticals, agrochemicals, or materials science, due to its unique structure and functional groups. Further research and testing are needed to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 82846-39-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,8,4 and 6 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 82846-39:
(7*8)+(6*2)+(5*8)+(4*4)+(3*6)+(2*3)+(1*9)=157
157 % 10 = 7
So 82846-39-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H9Br3O4/c16-8-3-7(15(22)11(18)4-8)1-2-12(19)9-5-10(17)14(21)6-13(9)20/h1-6,20-22H/b2-1+