82875-66-9 Usage
Description
1-(2-(s-Hydrindacen-4-yl)ethyl)-4-(2-hydroxyethyl)piperazine dihydrochloride hemihydrate is a complex organic compound featuring a piperazine ring structure with two distinct side chains. The piperazine ring is substituted with a hydroxyethyl group and a s-hydrindacen-4-yl ethyl group, and the compound exists in dihydrochloride form, including a water molecule as a hemihydrate. Its unique structural composition and potential biological activity suggest possible applications in the pharmaceutical and research industries.
Uses
Used in Pharmaceutical Applications:
1-(2-(s-Hydrindacen-4-yl)ethyl)-4-(2-hydroxyethyl)piperazine dihydrochloride hemihydrate is used as a pharmaceutical compound for its potential therapeutic effects. The specific application reason is attributed to its unique structure, which may interact with biological targets and exhibit desired pharmacological properties.
Used in Research and Development:
In the research industry, 1-(2-(s-Hydrindacen-4-yl)ethyl)-4-(2-hydroxyethyl)piperazine dihydrochloride hemihydrate is used as a chemical probe for studying its interactions with various biological systems. The application reason is to gain insights into its potential biological activities and to explore its utility in drug discovery and development processes.
Please note that the specific applications and reasons mentioned above are hypothetical and based on the general properties of the compound. Further research and experimentation would be required to confirm its actual uses and benefits in these industries.
Check Digit Verification of cas no
The CAS Registry Mumber 82875-66-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,8,7 and 5 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 82875-66:
(7*8)+(6*2)+(5*8)+(4*7)+(3*5)+(2*6)+(1*6)=169
169 % 10 = 9
So 82875-66-9 is a valid CAS Registry Number.
InChI:InChI=1/C20H30N2O.2ClH/c23-14-13-22-11-9-21(10-12-22)8-7-20-18-5-1-3-16(18)15-17-4-2-6-19(17)20;;/h15,23H,1-14H2;2*1H