82935-30-6 Usage
General Description
(S)-(-)-2-((3-Bromo-2,6-diethoxybenzamido)methyl)-1-ethylpyrrolidine hydrochloride is a chemical compound with a unique structure, consisting of a pyrrolidine ring with an ethyl and benzamidoethyl group attached at different positions. The presence of a bromo and diethoxy group on the benzamidoethyl moiety adds to its complexity and potential reactivity. The compound is also in the hydrochloride form, indicating that it has been reacted with hydrochloric acid to form a more stable salt. This chemical may have applications in drug development and various chemical processes, owing to its intricate structure and potential biological activity. Further research and analysis are needed to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 82935-30-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,9,3 and 5 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 82935-30:
(7*8)+(6*2)+(5*9)+(4*3)+(3*5)+(2*3)+(1*0)=146
146 % 10 = 6
So 82935-30-6 is a valid CAS Registry Number.
InChI:InChI=1/C18H27BrN2O3.ClH/c1-4-21-11-7-8-13(21)12-20-18(22)16-15(23-5-2)10-9-14(19)17(16)24-6-3;/h9-10,13H,4-8,11-12H2,1-3H3,(H,20,22);1H/t13-;/m0./s1