82952-65-6 Usage
Molecular structure
The compound has a complex structure that includes a pyrrolidine ring and a benzamido group.
Substituents
The presence of dibromo and dimethoxy substituents on the benzamido group.
Properties conferred by substituents
The dibromo and dimethoxy substituents on the benzamido group confer specific properties to the compound, such as increased lipophilicity and potential binding affinity to certain biological targets.
Salt form
The hydrochloride salt form ensures the compound's stability and solubility, which is important for its potential pharmaceutical applications.
Potential applications
"2-((3,5-Dibromo-2,6-dimethoxybenzamido)methyl)-1-ethylpyrrolidine hydrochloride" may have potential applications in the pharmaceutical industry as a source of novel drug candidates.
Unique structure
The compound's unique structure may contribute to its potential biological activities and make it a valuable candidate for drug development.
Research tools
This compound could also be used in the development of new research tools and compounds for biological and chemical studies, expanding our understanding of various biological processes and potential therapeutic targets.
Check Digit Verification of cas no
The CAS Registry Mumber 82952-65-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,9,5 and 2 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 82952-65:
(7*8)+(6*2)+(5*9)+(4*5)+(3*2)+(2*6)+(1*5)=156
156 % 10 = 6
So 82952-65-6 is a valid CAS Registry Number.
InChI:InChI=1/C16H22Br2N2O3.ClH/c1-4-20-7-5-6-10(20)9-19-16(21)13-14(22-2)11(17)8-12(18)15(13)23-3;/h8,10H,4-7,9H2,1-3H3,(H,19,21);1H
