82975-15-3 Usage
Derivative of mannuronic acid
2,3-(1-acetyl-2-methyl-2-imidazolino-5,4)-2,3-dideoxymannuronic acid is derived from mannuronic acid, a sugar acid found in certain algae and bacteria.
Composition
The compound is composed of a unique arrangement of carbon, hydrogen, oxygen, and nitrogen atoms.
Complex chemical structure
The compound has a long and specific name, indicating its complex chemical structure.
Potential pharmaceutical applications
It has potential applications in pharmaceuticals, particularly in the development of new antibiotics and antiviral drugs.
Relevance to carbohydrate chemistry and biochemistry
The compound is significant in the study of carbohydrate chemistry and biochemistry.
Intriguing subject for research
Its precise structure and properties make it an intriguing subject for further research.
Potential applications in medicine and science
Due to its unique properties and structure, the compound has potential applications in various fields of medicine and science.
Check Digit Verification of cas no
The CAS Registry Mumber 82975-15-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,9,7 and 5 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 82975-15:
(7*8)+(6*2)+(5*9)+(4*7)+(3*5)+(2*1)+(1*5)=163
163 % 10 = 3
So 82975-15-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H14N2O6/c1-4-11-7(8(15)9(16)10(17)18)6(3-13)12(4)5(2)14/h3,6-9,15-16H,1-2H3,(H,17,18)/t6-,7-,8+,9+/m1/s1