832695-88-2 Usage
Description
3-(N-METHYLAMINOCARBONYL)PHENYLBORONIC ACID is an organic compound that serves as a key intermediate in the synthesis of various pharmaceutical compounds. It features a boronic acid group attached to a phenyl ring, with an N-methylaminocarbonylated side chain, which contributes to its reactivity and potential applications in medicinal chemistry.
Uses
Used in Pharmaceutical Industry:
3-(N-METHYLAMINOCARBONYL)PHENYLBORONIC ACID is used as a synthetic intermediate for the preparation of thiazolopyridinylacetamide derivatives and analogs. These compounds are of significant interest due to their potential as PI3K and mTOR kinase inhibitors, which are important targets for the development of drugs to treat various diseases, including cancer and other proliferative disorders.
In the pharmaceutical industry, 3-(N-METHYLAMINOCARBONYL)PHENYLBORONIC ACID plays a crucial role in the development of novel therapeutic agents that can modulate the activity of key signaling pathways involved in disease progression. Its unique chemical structure allows for the design and synthesis of a wide range of bioactive molecules with potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 832695-88-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,3,2,6,9 and 5 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 832695-88:
(8*8)+(7*3)+(6*2)+(5*6)+(4*9)+(3*5)+(2*8)+(1*8)=202
202 % 10 = 2
So 832695-88-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H10BNO3/c1-10-8(11)6-3-2-4-7(5-6)9(12)13/h2-5,12-13H,1H3,(H,10,11)
