83306-17-6 Usage
Chemical class
Pyrrolidinedione derivative
Functional groups
1-oxo (keto group)
3-(2-pyridylthio) (thioether linked to a pyridine ring)
Propoxy substituent (an ether linked to a three-carbon chain)
Molecular structure
A pyrrolidine ring fused to a dione (two carbonyl groups) with the mentioned functional groups attached
Target
Specific proteins in the body
Primary use
As a drug targeting proteins
Potential therapeutic applications
Inhibiting specific enzymes
Modulating cellular signaling pathways
Mechanisms of action
Still being studied
Pharmaceutical applications
Shows promise as a bioactive compound with potential pharmaceutical applications
Current status
Under investigation for its precise mechanisms of action and potential therapeutic uses
Check Digit Verification of cas no
The CAS Registry Mumber 83306-17-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,3,0 and 6 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 83306-17:
(7*8)+(6*3)+(5*3)+(4*0)+(3*6)+(2*1)+(1*7)=116
116 % 10 = 6
So 83306-17-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H12N2O4S/c15-10-4-5-11(16)14(10)18-12(17)6-8-19-9-3-1-2-7-13-9/h1-3,7H,4-6,8H2
