836-06-6 Usage
General Description
2,4-Diamino-5-(4-fluorobenzyl)pyrimidine is a chemical compound with the molecular formula C11H10FN5. It is a pyrimidine derivative that contains a fluorobenzyl group and two amino groups. 2,4-Diamino-5-(4-fluorobenzyl)pyrimidine is often used in the pharmaceutical industry as a building block for the synthesis of various pharmaceuticals, particularly those that act on the central nervous system. It has also been studied for its potential antiviral and anticancer properties. Additionally, 2,4-Diamino-5-(4-fluorobenzyl)pyrimidine has potential applications in the field of materials science, particularly in the development of novel organic electronic materials.
Check Digit Verification of cas no
The CAS Registry Mumber 836-06-6 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 8,3 and 6 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 836-06:
(5*8)+(4*3)+(3*6)+(2*0)+(1*6)=76
76 % 10 = 6
So 836-06-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H11FN4/c12-9-3-1-7(2-4-9)5-8-6-15-11(14)16-10(8)13/h1-4,6H,5H2,(H4,13,14,15,16)
