83699-45-0 Usage
Molecular structure
The compound has a tricyclic decyl backbone with a carbonyl group, an amino group, a carbamimido group, and a thioate group attached to it. The hydrogen bromide molecule is bonded to the compound.
Functional groups
The compound contains a carbamimido thioate functional group, which is a combination of a carbamate group and a thioate group.
Reactivity
The compound may be reactive and should be handled with care due to its potential toxicity.
Applications
The compound may have various applications in the chemical and pharmaceutical industries.
Formation
The compound is formed by the reaction of 2-((Tricyclo(3.3.1.1(sup 3,7))dec-1-ylcarbonyl)amino)ethyl carbamimido thioate with hydrobromic acid.
Check Digit Verification of cas no
The CAS Registry Mumber 83699-45-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,6,9 and 9 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 83699-45:
(7*8)+(6*3)+(5*6)+(4*9)+(3*9)+(2*4)+(1*5)=180
180 % 10 = 0
So 83699-45-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H23N3OS.BrH/c15-13(16)19-2-1-17-12(18)14-6-9-3-10(7-14)5-11(4-9)8-14;/h9-11H,1-8H2,(H3,15,16)(H,17,18);1H
