83710-00-3 Usage
Description
(1R,2E,6S,10E,11aS,13R,14aR)-1,6,7,8,9,11a,12,13,14,14a-Decahydro-1,13-dihydroxy-6-methyl-4H-cyclopenta[f]oxacyclotridecin-4-one is a complex organic molecule characterized by its cyclopenta[f]oxacyclotridecin-4-one ring structure. It consists of ten carbon atoms and two oxygen atoms, with multiple hydroxy groups attached to the ring. The molecule also features a methyl group and several double bonds, which contribute to its unique and potentially biologically active structure. Due to its complexity and specific stereochemistry, this compound may possess pharmacological or biological activities, making it a promising candidate for further research and study.
Uses
Used in Pharmaceutical Industry:
(1R,2E,6S,10E,11aS,13R,14aR)-1,6,7,8,9,11a,12,13,14,14a-Decahydro-1,13-dihydroxy-6-methyl-4H-cyclopenta[f]oxacyclotridecin-4-one is used as a potential pharmaceutical agent for its unique structure and potential biological activities. Its complex ring system and multiple functional groups may allow it to interact with various biological targets, offering opportunities for the development of new drugs and therapies.
Used in Research and Development:
In the field of organic chemistry and medicinal chemistry, (1R,2E,6S,10E,11aS,13R,14aR)-1,6,7,8,9,11a,12,13,14,14a-Decahydro-1,13-dihydroxy-6-methyl-4H-cyclopenta[f]oxacyclotridecin-4-one serves as a valuable compound for research and development. Its specific stereochemistry and potential biological activities make it an interesting subject for studying the structure-activity relationships of complex organic molecules and their interactions with biological systems.
Used in Drug Discovery:
(1R,2E,6S,10E,11aS,13aR)-1,6,7,8,9,11a,12,13,14,14a-Decahydro-1,13-dihydroxy-6-methyl-4H-cyclopenta[f]oxacyclotridecin-4-one is utilized in drug discovery processes to identify new lead compounds with potential therapeutic applications. Its unique structure and the presence of multiple functional groups make it a promising candidate for the development of novel drugs targeting various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 83710-00-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,7,1 and 0 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 83710-00:
(7*8)+(6*3)+(5*7)+(4*1)+(3*0)+(2*0)+(1*0)=113
113 % 10 = 3
So 83710-00-3 is a valid CAS Registry Number.
InChI:InChI=1/C16H24O4/c1-11-5-3-2-4-6-12-9-13(17)10-14(12)15(18)7-8-16(19)20-11/h4,6-8,11-15,17-18H,2-3,5,9-10H2,1H3/b6-4+,8-7-
83710-00-3Relevant articles and documents
Cyclopentenone Derivatives, VIII. - Reactions with Acetoxycyclopentenones, Brefeldin-A Cyclizations
Koeksal, Yetkin,Raddatz, Peter,Winterfeldt, Ekkehard
, p. 462 - 473 (2007/10/02)
Investigation of the lactonization process leading to brefeldin-A proves this reaction in the presense of a C4-thioacetal function not to be depending on the configuration at C15.Wittig-Horner cyclizations however, are shown to be stereospecific.
Production of cyanein by Penicillium simplicissimum.
Betina,Fuska,Kjaer,Kutkova,Nemec,Shapiro
, p. 115 - 117 (2007/10/10)
-
