83803-92-3 Usage
Description
[4-[2-(dimethylamino)ethoxy]-2-hydroxyphenyl] (4-methylphenyl) ketone hydrochloride is a complex organic compound featuring a ketone group, a hydroxyphenyl group, a dimethylaminoethoxy group, and a hydrochloride group. This unique combination of functional groups suggests potential applications in various fields, particularly in pharmaceutical or research settings, due to its possible interactions with biological systems.
Uses
Used in Pharmaceutical Industry:
[4-[2-(dimethylamino)ethoxy]-2-hydroxyphenyl] (4-methylphenyl) ketone hydrochloride is used as a potential pharmaceutical compound for its unique combination of functional groups, which may allow for specific interactions with biological systems and targeted therapeutic effects.
Used in Research and Development:
In the research and development sector, [4-[2-(dimethylamino)ethoxy]-2-hydroxyphenyl] (4-methylphenyl) ketone hydrochloride can be utilized as a starting material or a probe in the synthesis of novel compounds with potential applications in various fields, including drug discovery and chemical biology.
Check Digit Verification of cas no
The CAS Registry Mumber 83803-92-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,8,0 and 3 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 83803-92:
(7*8)+(6*3)+(5*8)+(4*0)+(3*3)+(2*9)+(1*2)=143
143 % 10 = 3
So 83803-92-3 is a valid CAS Registry Number.
InChI:InChI=1/C18H21NO3.ClH/c1-13-4-6-14(7-5-13)18(21)16-9-8-15(12-17(16)20)22-11-10-19(2)3;/h4-9,12,20H,10-11H2,1-3H3;1H
