83948-22-5 Usage
Chemical class
Pyrido[4,3-b]carbazole derivative
Explanation
The compound belongs to a class of chemical compounds derived from the pyrido[4,3-b]carbazole ring structure.
Explanation
The compound contains an ethylamino group (-NHCH2CH3) and a propylamino group (-NHCH2CH2CH3) attached to the pyrido[4,3-b]carbazole ring structure.
Explanation
The compound has a hydroxyl group (-OH) attached to the 9th position of the pyrido[4,3-b]carbazole ring.
Explanation
The compound has three methyl groups (-CH3) attached to the pyrido[4,3-b]carbazole ring at positions 5, 6, and 11.
Explanation
The molecular formula represents the total number of carbon (C), hydrogen (H), nitrogen (N), and oxygen (O) atoms in the compound.
Explanation
Due to its unique structure and properties, the compound may have various applications in these fields, such as in the development of new drugs, materials, or chemical processes.
Explanation
The solubility of the compound is not provided, but it may be influenced by the presence of polar and nonpolar functional groups in its structure.
Explanation
The stability of the compound is not provided, but it may be affected by various factors, including environmental conditions and the presence of other chemicals.
Explanation
The reactivity of the compound is not provided, but it may undergo reactions with other chemicals, such as acids, bases, or nucleophiles, depending on the presence of reactive functional groups.
Explanation
The compound has a complex structure with multiple functional groups and a large number of carbon atoms, making it a challenging target for synthesis and analysis.
Substituents
Ethylamino and propylamino groups
Hydroxyl group
Substituted at position 9
Methyl groups
Three methyl groups at positions 5, 6, and 11
Potential applications
Chemistry, pharmaceuticals, and materials science
Solubility
Unknown, but may vary depending on the solvent
Stability
Unknown, but may be influenced by factors such as temperature, pH, and exposure to light
Reactivity
Unknown, but may react with various reagents based on its functional groups
Structural complexity
High
Check Digit Verification of cas no
The CAS Registry Mumber 83948-22-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,3,9,4 and 8 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 83948-22:
(7*8)+(6*3)+(5*9)+(4*4)+(3*8)+(2*2)+(1*2)=165
165 % 10 = 5
So 83948-22-5 is a valid CAS Registry Number.
InChI:InChI=1/C23H28N4O/c1-5-24-10-6-11-25-23-21-15(3)20-18-13-16(28)7-8-19(18)27(4)22(20)14(2)17(21)9-12-26-23/h7-9,12-13,24,28H,5-6,10-11H2,1-4H3,(H,25,26)
83948-22-5Relevant articles and documents
Antitumor Amino-Substituted Pyridopyrroloisoquinolines and Pyridocarbazole Derivatives: Synthesis and Evaluation of Compoudns Resulting from New Side Chain and Heterocycle Modifications
Rivalle, Christian,Wendling, Francoise,Tambourin, Pierre,Lhoste, Jean-Marc,Bisagni, Emile,Chermann, Jean-Claude
, p. 181 - 185 (2007/10/02)
New modifications of 10-amino>-6-methyl-5H-pyridopyrroloisoquinoline (1b) and 1-amino>-9-methoxy-5,11-dimethyl-6H-pyridocarbazole (4b), which display important antitumor properties