84030-19-3 Usage
Description
FMOC-HIS(BZL)-OH, also known as 9-fluorenylmethoxycarbonyl-L-histidine(benzyl), is an amino acid derivative that plays a crucial role in chemical synthesis and peptide chemistry. It is characterized by the presence of a fluorenylmethoxycarbonyl (Fmoc) protecting group, which is commonly used in solid-phase peptide synthesis to protect the amino group of histidine. The benzyl group attached to the imidazole ring of histidine provides additional steric hindrance and stability to the molecule.
Uses
Used in Chemical Synthesis:
FMOC-HIS(BZL)-OH is used as a building block in chemical synthesis for the preparation of various organic compounds and pharmaceuticals. Its unique structure allows for selective reactions and modifications, making it a versatile component in the synthesis of complex molecules.
Used in Peptide Chemistry:
In peptide chemistry, FMOC-HIS(BZL)-OH is used as a protected amino acid for the synthesis of peptides and proteins. The Fmoc protecting group can be selectively removed under mild conditions, allowing for the stepwise assembly of peptide chains. This protects the amino group of histidine from unwanted side reactions during the synthesis process.
Used in Drug Discovery and Development:
FMOC-HIS(BZL)-OH is employed in drug discovery and development as a key component in the synthesis of bioactive peptides and peptidomimetics. Its incorporation into peptide sequences can modulate the biological activity, stability, and pharmacokinetic properties of the resulting compounds, leading to the development of novel therapeutic agents.
Used in Research and Diagnostics:
FMOC-HIS(BZL)-OH is also used in research and diagnostic applications, such as the synthesis of probes and markers for biological assays, as well as the development of new analytical methods for the detection and quantification of biomolecules.
Check Digit Verification of cas no
The CAS Registry Mumber 84030-19-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,0,3 and 0 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 84030-19:
(7*8)+(6*4)+(5*0)+(4*3)+(3*0)+(2*1)+(1*9)=103
103 % 10 = 3
So 84030-19-3 is a valid CAS Registry Number.
InChI:InChI=1/C28H25N3O4/c32-27(33)26(14-20-16-31(18-29-20)15-19-8-2-1-3-9-19)30-28(34)35-17-25-23-12-6-4-10-21(23)22-11-5-7-13-24(22)25/h1-13,16,18,25-26H,14-15,17H2,(H,30,34)(H,32,33)