84078-44-4 Usage
General Description
4-Pentylphenyl trans,trans-4'-propyl-1,1'-bicyclohexyl-4-carboxylate is a chemical compound that belongs to the family of cyclohexyl carboxylates. It is commonly used as a liquid crystal material in the production of liquid crystal displays (LCDs). 4-Pentylphenyl trans,trans-4'-propyl-1,1'-bicyclohexyl-4-carboxylate exhibits unique liquid crystal properties, making it suitable for use in various electronic devices such as televisions, computer monitors, and smartphones. Its chemical structure includes a pentylphenyl group and a propyl-bicyclohexyl group, which contribute to its characteristic properties. Additionally, the trans,trans configuration of the compound plays a critical role in determining its liquid crystal behavior. Overall, 4-Pentylphenyl trans,trans-4'-propyl-1,1'-bicyclohexyl-4-carboxylate is an important and widely used chemical in the electronics industry due to its liquid crystal properties.
Check Digit Verification of cas no
The CAS Registry Mumber 84078-44-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,0,7 and 8 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 84078-44:
(7*8)+(6*4)+(5*0)+(4*7)+(3*8)+(2*4)+(1*4)=144
144 % 10 = 4
So 84078-44-4 is a valid CAS Registry Number.
InChI:InChI=1/C27H42O2/c1-3-5-6-8-22-11-15-25(16-12-22)27(19-17-23(18-20-27)26(28)29)24-13-9-21(7-4-2)10-14-24/h11-12,15-16,21,23-24H,3-10,13-14,17-20H2,1-2H3,(H,28,29)/p-1