84145-39-1 Usage
Molecular structure
2,5-bis[(1,3-dioxobutyl)phenylamino]terephthalic acid is a terephthalic acid derivative with two 1,3-dioxobutylphenylamino groups substituted on the terephthalic acid core.
Unique properties
The compound has a unique molecular structure that gives it special properties, such as its use in the production of dyes, pigments, and polymers.
Industrial applications
The compound is commonly used in various industrial fields, such as the production of dyes, pigments, and polymers.
Scientific applications
2,5-bis[(1,3-dioxobutyl)phenylamino]terephthalic acid is also used as a building block in organic synthesis and as a potential drug candidate in medicinal chemistry.
Versatility
The chemical structure of the compound makes it a versatile and valuable compound in various industrial and scientific fields.
Check Digit Verification of cas no
The CAS Registry Mumber 84145-39-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,1,4 and 5 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 84145-39:
(7*8)+(6*4)+(5*1)+(4*4)+(3*5)+(2*3)+(1*9)=131
131 % 10 = 1
So 84145-39-1 is a valid CAS Registry Number.
InChI:InChI=1/C28H24N2O8/c1-15(31)11-25(33)17-7-3-5-9-21(17)29-23-13-20(28(37)38)24(14-19(23)27(35)36)30-22-10-6-4-8-18(22)26(34)12-16(2)32/h3-10,13-14,29-30H,11-12H2,1-2H3,(H,35,36)(H,37,38)