84145-41-5 Usage
Description
(Z)-N-Ethyl-2-(6-methyl-3-pyridyl)vinylamine is a vinylamine derivative with the molecular formula C12H15N. It has a trans configuration, with the ethyl and methyl-pyridyl groups positioned opposite each other on the carbon-carbon double bond. The presence of the vinylamine group makes it a valuable building block for the synthesis of various organic compounds. Additionally, the (Z) configuration of the compound gives it specific stereochemical properties that are important for its reactivity and biological activity.
Uses
Used in Pharmaceutical Industry:
(Z)-N-Ethyl-2-(6-methyl-3-pyridyl)vinylamine is used as a building block for the synthesis of various pharmaceuticals. Its unique molecular structure and properties make it a promising candidate for the development of new drugs.
Used in Agrochemical Industry:
(Z)-N-Ethyl-2-(6-methyl-3-pyridyl)vinylamine is also used as a building block for the synthesis of agrochemicals. Its specific stereochemical properties and reactivity contribute to the development of effective and targeted agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 84145-41-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,1,4 and 5 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 84145-41:
(7*8)+(6*4)+(5*1)+(4*4)+(3*5)+(2*4)+(1*1)=125
125 % 10 = 5
So 84145-41-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H14N2/c1-3-11-7-6-10-5-4-9(2)12-8-10/h4-8,11H,3H2,1-2H3/b7-6-