84249-82-1 Usage
Chemical structure
The compound has a 1,3,4-oxadiazole core, which is a heterocyclic structure containing oxygen, nitrogen, and sulfur atoms.
Substituents
The core is substituted with a 3,5-dichlorophenylamino methyl group and a 4-pyridinyl group, which contribute to its unique chemical properties and potential applications.
Heterocyclic compound
It is a heterocyclic compound, which means it contains a ring of atoms with at least one atom being different from carbon.
Potential pharmaceutical applications
The compound may have properties that make it useful in drug discovery and development, particularly as a therapeutic agent for various diseases and disorders.
Biological activities
Research and studies on this compound may reveal its biological activities, which could include interactions with specific biological targets or pathways.
Mechanisms of action
Further investigation may uncover the compound's mechanisms of action, providing insights into how it exerts its potential therapeutic effects.
Drug design and synthesis
The compound's structure and properties may inform the design and synthesis of new drugs, potentially leading to the development of more effective treatments for various conditions.
Research focus
The compound's potential as a therapeutic agent and its unique chemical structure make it an interesting subject for further research and development in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 84249-82-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,2,4 and 9 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 84249-82:
(7*8)+(6*4)+(5*2)+(4*4)+(3*9)+(2*8)+(1*2)=151
151 % 10 = 1
So 84249-82-1 is a valid CAS Registry Number.
InChI:InChI=1/C14H10Cl2N4OS/c15-10-5-11(16)7-12(6-10)18-8-20-14(22)21-13(19-20)9-1-3-17-4-2-9/h1-7,18H,8H2
