84260-27-5 Usage
Organosilicon compound
Cyclic structure with a silicon atom
A compound containing a silicon atom bonded to carbon atoms, forming a cyclic structure.
Heterocyclic structure
Contains nitrogen and sulfur atoms
A ring structure with non-carbon atoms (nitrogen and sulfur) in the ring, giving the compound unique properties.
Cyclic pentane structure
Five carbon atoms form a closed ring
A carbon chain with five members forming a ring, which is the backbone of the compound.
Substituents
Methyl and p-fluorophenyl groups attached to the silicon atom
A methyl group (CH3) and a p-fluorophenyl group (C6H4F) are bonded to the silicon atom, contributing to the compound's properties and reactivity.
Potential applications
Pharmaceutical, materials science, and organic chemistry
Due to its unique structure and properties, the compound may have various applications in fields such as drug development, material synthesis, and organic synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 84260-27-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,2,6 and 0 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 84260-27:
(7*8)+(6*4)+(5*2)+(4*6)+(3*0)+(2*2)+(1*7)=125
125 % 10 = 5
So 84260-27-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H12FNSSi/c1-13(11-6-7-12-13)9-4-2-8(10)3-5-9/h2-5,11H,6-7H2,1H3
