84434-32-2 Usage
General Description
The chemical "2-[3-[5,6-dichloro-1,3-dihydro-1-(2-hydroxyethyl)-3-methyl-2H-benzimidazol-2-ylidene]prop-1-enyl]-3-ethyl-5-phenylbenzoxazolium toluene-p-sulphonate" is a complex organic compound. It is composed of a benzoxazolium core with multiple side chains including a dichloro group, a hydroxyethyl group, a methyl group, and an ethyl group. Additionally, it contains a benzimidazol-2-ylidene group and a toluene-p-sulphonate group. This chemical likely has various applications in the field of organic synthesis, chemical engineering, or pharmacology due to its unique structure and potential reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 84434-32-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,4,3 and 4 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 84434-32:
(7*8)+(6*4)+(5*4)+(4*3)+(3*4)+(2*3)+(1*2)=132
132 % 10 = 2
So 84434-32-2 is a valid CAS Registry Number.
InChI:InChI=1/C28H26Cl2N3O2.C7H8O3S/c1-3-32-25-16-20(19-8-5-4-6-9-19)12-13-26(25)35-28(32)11-7-10-27-31(2)23-17-21(29)22(30)18-24(23)33(27)14-15-34;1-6-2-4-7(5-3-6)11(8,9)10/h4-13,16-18,34H,3,14-15H2,1-2H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1