84483-22-7 Usage
Description
3-Chloro-2,6-dibromo-4-methylaniline is an organic compound with the chemical formula C7H6Br2ClN. It is characterized by the presence of a chlorine atom at the 3-position, two bromine atoms at the 2 and 6 positions, and a methyl group at the 4-position attached to an aniline moiety. 3-CHLORO-2,6-DIBROMO-4-METHYLANILINE exhibits unique chemical properties due to its halogenated structure, making it a versatile intermediate in the synthesis of various organic compounds.
Uses
Used in Pharmaceutical Industry:
3-Chloro-2,6-dibromo-4-methylaniline is used as a key intermediate in the synthesis of anti-cancer derivatives. Its unique structure allows for the development of novel compounds with potential anti-cancer properties, offering new therapeutic options for the treatment of various types of cancer.
Used in Chemical Synthesis:
Due to its reactive halogenated structure, 3-chloro-2,6-dibromo-4-methylaniline can be employed as a building block in the synthesis of various organic compounds, including pharmaceuticals, agrochemicals, and other specialty chemicals. Its versatility in chemical reactions makes it a valuable component in the development of new and innovative products.
Check Digit Verification of cas no
The CAS Registry Mumber 84483-22-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,4,8 and 3 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 84483-22:
(7*8)+(6*4)+(5*4)+(4*8)+(3*3)+(2*2)+(1*2)=147
147 % 10 = 7
So 84483-22-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H6Br2ClN/c1-3-2-4(8)7(11)5(9)6(3)10/h2H,11H2,1H3
84483-22-7Relevant articles and documents
Anti-quinazoline compounds
-
Page column 13-14, (2010/02/05)
Dihydroquinazoline derivatives of the formula where R3is —(CH2)p—A where p is from 1 to 4 and A is a 5- or 6-membered N-containing heterocyclic ring attached via the N atom or A is —NA′A″ wherein A′ and A″ are the same or different and are each a C1-C4alkyl group or their pharmaceutically acceptable salts possessing anti-cancer activity.