845266-22-0 Usage
Type of compound
Organic compound
Contains
Thioether group
Contains
Nitro group
Contains
Thienyl ring
Potential applications
Pharmaceuticals and organic synthesis
Unique structure
May contribute to its reactivity and potential bioactive properties
Further study needed
To explore potential uses and properties
Building block
Could be used for the synthesis of more complex organic molecules
Check Digit Verification of cas no
The CAS Registry Mumber 845266-22-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,4,5,2,6 and 6 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 845266-22:
(8*8)+(7*4)+(6*5)+(5*2)+(4*6)+(3*6)+(2*2)+(1*2)=180
180 % 10 = 0
So 845266-22-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H9NO4S2/c1-5(11)7-4-6(9(12)13)8(15-7)14-3-2-10/h4,10H,2-3H2,1H3