845266-23-1 Usage
Description
5-ACETYL-3,4-DIMETHYLTHIENO[2,3-B]THIOPHENE-2-CARBONITRILE is a carbocyclic compound with a molecular formula C12H9NOS. It features a thienothiophene core and a nitrile group attached to carbon 2. This unique structure and the presence of functional groups make it a significant building block in the development of various organic molecules and pharmaceutical drugs.
Uses
Used in Organic Synthesis:
5-ACETYL-3,4-DIMETHYLTHIENO[2,3-B]THIOPHENE-2-CARBONITRILE is used as a key intermediate in organic synthesis for the creation of complex organic molecules. Its versatile structure allows for multiple synthetic pathways, making it a valuable component in the synthesis of a wide range of compounds.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 5-ACETYL-3,4-DIMETHYLTHIENO[2,3-B]THIOPHENE-2-CARBONITRILE is used as a starting material for the synthesis of biologically active compounds. Its potential applications in medicinal chemistry and drug development are vast, as it can contribute to the discovery and creation of new pharmaceutical agents with various therapeutic properties.
Used in Medicinal Chemistry:
5-ACETYL-3,4-DIMETHYLTHIENO[2,3-B]THIOPHENE-2-CARBONITRILE is utilized in medicinal chemistry as a structural component in the design and development of new drugs. Its unique core and functional groups can be modified to create molecules with specific biological activities, making it an important tool in the advancement of pharmaceutical compounds.
Used in Drug Development:
In drug development, 5-ACETYL-3,4-DIMETHYLTHIENO[2,3-B]THIOPHENE-2-CARBONITRILE serves as a valuable precursor for the synthesis of potential drug candidates. Its role in the creation of new therapeutic agents is crucial, as it can be tailored to target specific diseases and conditions, leading to the development of innovative treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 845266-23-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,4,5,2,6 and 6 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 845266-23:
(8*8)+(7*4)+(6*5)+(5*2)+(4*6)+(3*6)+(2*2)+(1*3)=181
181 % 10 = 1
So 845266-23-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H9NOS2/c1-5-8(4-12)14-11-9(5)6(2)10(15-11)7(3)13/h1-3H3
