84540-54-5 Usage
Type of compound
Nitrile derivative
Parent compound
Benzo[b]fluorene (a polycyclic aromatic hydrocarbon)
Common use
Starting material in the synthesis of various organic compounds
Applications
Pharmaceutical and agrochemical industries
Potential use
Fluorescent probe in biological imaging studies
Versatility
Wide range of potential applications in organic chemistry and materials science
Chemical structure
Consists of a benzene ring fused to a fluorene ring, with a nitrile group (C≡N) attached to one of the carbon atoms in the benzene ring
Physical state
Likely a solid at room temperature, based on its molecular size and complexity
Stability
Relatively stable under normal conditions, but may be sensitive to heat, light, or strong acids/bases
Reactivity
Can undergo various chemical reactions, such as addition, substitution, and reduction, due to the presence of the nitrile group and the aromatic rings
Hazards
Potentially toxic and harmful if inhaled, ingested, or absorbed through the skin; proper handling and storage are necessary to minimize exposure risks
Environmental impact
May be persistent in the environment due to its stability, and could potentially accumulate in living organisms
Regulatory status
Depending on the jurisdiction, 11H-benzo[b]fluorenecarbonitrile may be subject to specific handling, storage, and disposal regulations due to its potential hazards and environmental impact.
Check Digit Verification of cas no
The CAS Registry Mumber 84540-54-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,5,4 and 0 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 84540-54:
(7*8)+(6*4)+(5*5)+(4*4)+(3*0)+(2*5)+(1*4)=135
135 % 10 = 5
So 84540-54-5 is a valid CAS Registry Number.
InChI:InChI=1/C18H11N/c19-11-14-6-3-7-16-17(14)10-15-8-12-4-1-2-5-13(12)9-18(15)16/h1-9H,10H2
