84788-01-2 Usage
Chemical class
1,2,4-triazolium salts
Appearance
Yellow to brownish powder
Potential applications
Dye chemistry and organic synthesis
1,2,4-triazole ring
A five-membered heterocyclic ring containing three nitrogen atoms and two carbon atoms
Azo group
A functional group with a nitrogen-nitrogen double bond (-N=N-) that may contribute to photochromic properties
Phenyl-indole moiety
A part of the molecule that includes a phenyl group attached to an indole, which may contribute to photophysical properties
Photochromic properties
The ability to change color upon exposure to light, making it potentially useful in the development of photoactive materials and dyes
Photophysical properties
The study of the interaction of light with matter, which may be relevant for this compound due to the presence of the azo group and phenyl-indole moiety
Solubility
Water-soluble due to the chloride salt form, allowing for use in various aqueous-based applications
Fields of potential use
Dye chemistry and materials science
Check Digit Verification of cas no
The CAS Registry Mumber 84788-01-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,4,7,8 and 8 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 84788-01:
(7*8)+(6*4)+(5*7)+(4*8)+(3*8)+(2*0)+(1*1)=172
172 % 10 = 2
So 84788-01-2 is a valid CAS Registry Number.
InChI:InChI=1/C18H18N6.ClH/c1-23-12-19-24(2)18(23)22-21-17-14-10-6-7-11-15(14)20-16(17)13-8-4-3-5-9-13;/h3-12,18,22H,1-2H3;1H/p-1/b21-17+;