85-78-9 Usage
Derivative of benzoic acid
It is a modified version of benzoic acid This means that the compound is structurally related to benzoic acid, with some modifications in its chemical structure.
Contains a phenyl group
A phenyl group (a ring of six carbon atoms with a hydrogen atom attached to each carbon) is part of the compound This group is a common structural unit in many organic compounds and contributes to the compound's properties.
Attached to a quinoline ring
The phenyl group is connected to a quinoline ring (a bicyclic compound with a nitrogen atom in the seven-membered ring) This ring structure is responsible for some of the compound's unique properties and potential applications.
Used in synthetic chemistry and chemical research
The compound serves as a building block for creating more complex molecules This means that it can be used as a starting material to synthesize a variety of other compounds with different properties and applications.
Potential applications in pharmaceuticals and drug development
Due to its structural features and potential biological activity, the compound may be useful in the development of new drugs This suggests that it could have therapeutic effects or be a key component in the design of new medications.
Fluorescent probe
The compound may be used as a fluorescent probe for studying biological processes This means that it can be used to track and visualize specific processes within cells or organisms, such as protein-protein interactions and cellular imaging.
Check Digit Verification of cas no
The CAS Registry Mumber 85-78-9 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 8 and 5 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 85-78:
(4*8)+(3*5)+(2*7)+(1*8)=69
69 % 10 = 9
So 85-78-9 is a valid CAS Registry Number.
InChI:InChI=1/C23H16N2O3/c26-22(25-20-13-7-5-11-17(20)23(27)28)18-14-21(15-8-2-1-3-9-15)24-19-12-6-4-10-16(18)19/h1-14H,(H,25,26)(H,27,28)/p-1