85008-85-1 Usage
Chemical structure
A heterocyclic compound with two fused benzene rings, an azepine ring, and a pyrazolo ring.
Complexity
The compound has a unique and complex structure.
Commonality
It is not commonly found or used in everyday products or applications.
Research and use
Its properties and potential uses are not well known due to limited research and use in the scientific community.
Functional groups
The compound contains aromatic rings, nitrogen-containing heterocycles, and phenyl groups.
Physical state
Likely a solid at room temperature, given its complex structure and molecular weight.
Solubility
The compound may be more soluble in organic solvents like ethanol or methanol due to its nonpolar nature.
Stability
The stability of the compound is not well documented, but it may be sensitive to heat, light, or moisture due to its complex structure.
Reactivity
The compound may undergo reactions such as electrophilic aromatic substitution, nucleophilic aromatic substitution, or oxidation, depending on the specific reaction conditions and reagents used.
Synthesis
The synthesis of this compound likely involves multiple steps, including the formation of the benzene rings, the azepine ring, and the pyrazolo ring, followed by the introduction of the phenyl groups.
Applications
Due to its limited research and use, the potential applications of this compound are not well known. It may have potential uses in the pharmaceutical, chemical, or materials science industries, but further research is needed to explore these possibilities.
Check Digit Verification of cas no
The CAS Registry Mumber 85008-85-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,0,0 and 8 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 85008-85:
(7*8)+(6*5)+(5*0)+(4*0)+(3*8)+(2*8)+(1*5)=131
131 % 10 = 1
So 85008-85-1 is a valid CAS Registry Number.
InChI:InChI=1/C27H21N3/c1-3-11-19(12-4-1)26-25-21-15-7-9-17-23(21)28-24-18-10-8-16-22(24)27(25)30(29-26)20-13-5-2-6-14-20/h1-18,25,27-28H