850567-31-6 Usage
Description
3-(2-(DIMETHYLAMINO)ETHYLCARBAMOYL)PHENYLBORONIC ACID is a chemical compound that serves as a reagent or reactant in various organic synthesis and reactions. It is characterized by its unique structure, which includes a boronic acid group attached to a phenyl ring through a carbamoyl linkage, and a dimethylaminoethyl group that provides additional reactivity and functionality.
Uses
Used in Organic Synthesis:
3-(2-(DIMETHYLAMINO)ETHYLCARBAMOYL)PHENYLBORONIC ACID is used as a reagent or reactant for organic synthesis, enabling the formation of new chemical bonds and the creation of a wide range of organic compounds. Its unique structure allows it to participate in various types of reactions, such as Suzuki-Miyaura cross-coupling, which is a widely used method for the formation of carbon-carbon bonds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-(2-(DIMETHYLAMINO)ETHYLCARBAMOYL)PHENYLBORONIC ACID is used as a building block or intermediate in the synthesis of various drug molecules. Its ability to form stable bonds with other organic compounds makes it a valuable component in the development of new pharmaceuticals with improved efficacy and selectivity.
Used in Material Science:
3-(2-(DIMETHYLAMINO)ETHYLCARBAMOYL)PHENYLBORONIC ACID is also used in material science for the development of new materials with specific properties. Its reactivity and functional groups can be utilized to create materials with tailored characteristics, such as improved conductivity, stability, or responsiveness to external stimuli.
Overall, 3-(2-(DIMETHYLAMINO)ETHYLCARBAMOYL)PHENYLBORONIC ACID is a versatile chemical compound with a wide range of applications in various industries, including organic synthesis, pharmaceuticals, and material science. Its unique structure and reactivity make it a valuable tool for the development of new compounds and materials with diverse properties and functions.
Check Digit Verification of cas no
The CAS Registry Mumber 850567-31-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 7 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 850567-31:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*7)+(2*3)+(1*1)=176
176 % 10 = 6
So 850567-31-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H17BN2O3/c1-14(2)7-6-13-11(15)9-4-3-5-10(8-9)12(16)17/h3-5,8,16-17H,6-7H2,1-2H3,(H,13,15)