850568-28-4 Usage
General Description
4-(Thiomorpholin-4-ylcarbonyl)benzeneboronic acid is a synthetic organic compound characterized by the presence of a boronic acid functional group and a benzene ring in its structure. As a boronic acid compound, it plays a crucial role in various chemical synthesis processes because of its inherent ability to form stable covalent bonds with other compounds. Its unique structural composition makes it a valuable substance in numerous research fields, particularly in pharmaceutical chemistry where it's often used as an ingredient in the formulation of therapeutic compounds or as a critical component in chemical reactions during drug synthesis processes. However, like many synthetic chemicals, it should be handled with caution due to potential reactive or hazardous properties, though specific risks or safety measures would depend on the nature of its usage.
Check Digit Verification of cas no
The CAS Registry Mumber 850568-28-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 8 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 850568-28:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*8)+(2*2)+(1*8)=184
184 % 10 = 4
So 850568-28-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H14BNO3S/c14-11(13-5-7-17-8-6-13)9-1-3-10(4-2-9)12(15)16/h1-4,15-16H,5-8H2
