850568-30-8 Usage
General Description
N-(thiazoline-2-yl) 4-boronobenzamide is a compound with a thiazoline ring attached to a boronobenzamide group. It is often used as a ligand in coordination chemistry and organometallic chemistry. The boron atom in the compound can act as a Lewis acid, making this molecule a potential candidate for catalytic processes. Additionally, the thiazoline ring contains a sulfur atom and a nitrogen atom, which can potentially participate in various chemical reactions. N-(THIAZOLINE-2-YL) 4-BORONOBENZAMIDE has shown promise in various applications, including medicinal chemistry and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 850568-30-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,5,6 and 8 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 850568-30:
(8*8)+(7*5)+(6*0)+(5*5)+(4*6)+(3*8)+(2*3)+(1*0)=178
178 % 10 = 8
So 850568-30-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H11BN2O3S/c14-9(13-10-12-5-6-17-10)7-1-3-8(4-2-7)11(15)16/h1-4,15-16H,5-6H2,(H,12,13,14)