85168-85-0 Usage
General Description
Bromochloroanthra[2,1,9-mna]benz[6,7]indazolo[2,3,4-fgh]acridine-5,10-dione is a complex chemical compound with a long, systematic name. It is a type of anthraquinone, a class of organic compounds known for their vivid colors and wide range of applications. This specific compound contains both bromine and chlorine atoms, as well as an acridine-5,10-dione core structure. It may have potential uses in various fields, such as materials science, pharmaceuticals, or dye synthesis, given its intricate molecular structure and potentially unique properties. However, further research and analysis would be needed to fully understand its characteristics and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 85168-85-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,1,6 and 8 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 85168-85:
(7*8)+(6*5)+(5*1)+(4*6)+(3*8)+(2*8)+(1*5)=160
160 % 10 = 0
So 85168-85-0 is a valid CAS Registry Number.
InChI:InChI=1/C31H12BrClN2O2/c32-27-21(33)11-9-19-24(27)17-10-12-22-25-13(5-7-18(23(17)25)31(19)37)15-6-8-20-26-28(34-35(22)29(15)26)14-3-1-2-4-16(14)30(20)36/h1-12H