852180-67-7 Usage
General Description
N-Methyl-N-(3-pyridin-4-ylbenzyl)amine is a chemical compound with the molecular formula C15H17N. It is a tertiary amine with a methyl group substituted at the nitrogen atom. N-METHYL-N-(3-PYRIDIN-4-YLBENZYL)AMINE has a pyridine and benzyl group attached to the nitrogen atom, making it a heterocyclic amine. It is commonly used in organic synthesis and pharmaceutical research as a building block or intermediate for the production of various drugs and biologically active compounds. Additionally, the chemical structure of N-methyl-N-(3-pyridin-4-ylbenzyl)amine allows it to participate in a variety of chemical reactions, making it a versatile and valuable compound in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 852180-67-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,2,1,8 and 0 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 852180-67:
(8*8)+(7*5)+(6*2)+(5*1)+(4*8)+(3*0)+(2*6)+(1*7)=167
167 % 10 = 7
So 852180-67-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H14N2/c1-14-10-11-3-2-4-13(9-11)12-5-7-15-8-6-12/h2-9,14H,10H2,1H3
