852180-94-0 Usage
General Description
3-(1,3-Dioxolan-2-yl)-4-fluorobenzoic acid is a chemical compound with the molecular formula C10H9FO4. It is typically used in organic synthesis and pharmaceutical research as a building block for various molecules and drug candidates. 3-(1,3-Dioxolan-2-yl)-4-fluorobenzoicacid contains a 4-fluorobenzoic acid moiety with a 1,3-dioxolane ring attached to it. The presence of both the fluorine and dioxolane groups on the benzene ring makes this compound useful in the development of novel pharmaceuticals and agrochemicals. Additionally, it may have potential applications as a catalyst or reagent in organic reactions due to its unique chemical structure. Further research and experimentation may reveal additional uses and properties of 3-(1,3-Dioxolan-2-yl)-4-fluorobenzoic acid.
Check Digit Verification of cas no
The CAS Registry Mumber 852180-94-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,2,1,8 and 0 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 852180-94:
(8*8)+(7*5)+(6*2)+(5*1)+(4*8)+(3*0)+(2*9)+(1*4)=170
170 % 10 = 0
So 852180-94-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H9FO4/c11-8-2-1-6(9(12)13)5-7(8)10-14-3-4-15-10/h1-2,5,10H,3-4H2,(H,12,13)
