85237-85-0 Usage
Type of compound
Acetylated derivative of L-glutamic acid
L-glutamic acid
An important amino acid involved in protein synthesis and neurotransmission
Potential applications
Pharmaceutical and medical research
Neuroprotective properties
Studied for its potential to protect neurons from damage
Anti-inflammatory properties
Investigated for its potential to reduce inflammation in the body
Treatment of neurodegenerative diseases
Explored for its role in the treatment of conditions such as Alzheimer's and Parkinson's disease
Precursor for synthesis
Investigated as a potential precursor for the synthesis of new pharmaceutical compounds
Field of interest
Medicinal chemistry and drug development
Check Digit Verification of cas no
The CAS Registry Mumber 85237-85-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,2,3 and 7 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 85237-85:
(7*8)+(6*5)+(5*2)+(4*3)+(3*7)+(2*8)+(1*5)=150
150 % 10 = 0
So 85237-85-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H13NO5/c1-5(11)4-8(14)9(10-6(2)12)15-7(3)13/h9H,4H2,1-3H3,(H,10,12)