85248-84-6 Usage
Description
(S)-1-benzoyl-N,N-dihexyl-5-oxopyrrolidine-2-carboxamide is a chemical compound that belongs to the class of pyrrolidine carboxamides. It is composed of a benzoyl group, two hexyl chains, and a pyrrolidine ring with a carboxamide functional group. Its unique structure and properties make it valuable for potential applications in the field of medicinal chemistry and drug development.
Uses
Used in Pharmaceutical Industry:
(S)-1-benzoyl-N,N-dihexyl-5-oxopyrrolidine-2-carboxamide is used as a pharmaceutical intermediate for the synthesis of various drugs. Its unique structure allows it to be a versatile building block in the development of new pharmaceutical compounds.
Used in Organic Synthesis:
(S)-1-benzoyl-N,N-dihexyl-5-oxopyrrolidine-2-carboxamide is used as a reagent in organic synthesis. Its functional groups can be utilized in various chemical reactions to produce a wide range of organic compounds.
Further research and studies are needed to explore the full range of potential uses and properties of (S)-1-benzoyl-N,N-dihexyl-5-oxopyrrolidine-2-carboxamide.
Check Digit Verification of cas no
The CAS Registry Mumber 85248-84-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,2,4 and 8 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 85248-84:
(7*8)+(6*5)+(5*2)+(4*4)+(3*8)+(2*8)+(1*4)=156
156 % 10 = 6
So 85248-84-6 is a valid CAS Registry Number.
InChI:InChI=1/C24H36N2O3/c1-3-5-7-12-18-25(19-13-8-6-4-2)24(29)21-16-17-22(27)26(21)23(28)20-14-10-9-11-15-20/h9-11,14-15,21H,3-8,12-13,16-19H2,1-2H3/t21-/m0/s1