85263-80-5 Usage
General Description
1-(3,4-Dimethoxyphenethyl)-5-oxo-3-pyrrolidinecarboxylic acid is a chemical compound that consists of a pyrrolidine ring with a carboxylic acid and a phenethyl group with two methoxy substitutions. It is a derivative of phencyclidine, a dissociative anesthetic drug, and likely exhibits similar pharmacological properties. The compound's structure suggests that it may have psychoactive effects, potentially affecting the central nervous system. Additionally, the presence of the carboxylic acid group indicates that it is a weak acid, which may impact its solubility and bioavailability in biological systems. Further research is needed to fully understand the potential uses and effects of this chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 85263-80-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,2,6 and 3 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 85263-80:
(7*8)+(6*5)+(5*2)+(4*6)+(3*3)+(2*8)+(1*0)=145
145 % 10 = 5
So 85263-80-5 is a valid CAS Registry Number.
InChI:InChI=1/C15H19NO5/c1-20-12-4-3-10(7-13(12)21-2)5-6-16-9-11(15(18)19)8-14(16)17/h3-4,7,11H,5-6,8-9H2,1-2H3,(H,18,19)/p-1/t11-/m1/s1
