85579-17-5 Usage
Structure
A complex organic compound with a polycyclic aromatic structure, containing oxygen, nitrogen, and sulfur atoms.
Classification
Heterocyclic compound due to the presence of multiple different heteroatoms (oxygen, nitrogen, and sulfur) in its molecular structure.
Chemical Properties
Unique and complex chemical properties, which make it suitable for organic synthesis and the development of pharmaceutical compounds.
Organic Synthesis
Used as a starting material in the synthesis of various complex organic molecules.
Pharmaceutical Development
Potentially used in the development of pharmaceutical compounds due to its unique chemical properties.
Materials Science
Has potential applications in the field of materials science, possibly as a component in the development of new materials or as a precursor for other compounds.
Stability
The stability of the compound may depend on various factors such as temperature, pressure, and the presence of other chemicals. Further research would be needed to determine its stability under different conditions.
Reactivity
The compound may exhibit reactivity with certain chemicals, particularly those that can interact with its heteroatoms or aromatic structure. This reactivity could be useful in organic synthesis and pharmaceutical development.
Solubility
The solubility of the compound in various solvents may depend on its molecular structure and the specific solvents being used. Further research would be needed to determine its solubility profile.
Toxicity
The toxicity of the compound is not mentioned in the provided material. However, it is important to consider the potential toxicity of any compound, especially when used in pharmaceutical development or materials science applications.
Environmental Impact
The environmental impact of the compound is not mentioned in the provided material. However, it is important to consider the potential environmental impact of any compound, particularly when used in large-scale industrial processes or when released into the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 85579-17-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,5,7 and 9 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 85579-17:
(7*8)+(6*5)+(5*5)+(4*7)+(3*9)+(2*1)+(1*7)=175
175 % 10 = 5
So 85579-17-5 is a valid CAS Registry Number.
InChI:InChI=1/C5H4N2O2S2/c1-3-5-4(2-10-1)7-9-11(5)8-6-3/h1-2H2
85579-17-5Relevant articles and documents
The Synthesis and Electrochemical Properties of Some Novel Photosynthesis Electron Acceptors
Camilleri, Patrick,Clark, Michael T.,Gilmore, Ian J.,Cole-Hamilton, David
, p. 833 - 836 (2007/10/02)
A range of dioxathiadiaza heteropentalenes have been prepared and their electrochemical properties have been studied by cyclic voltammetry and e.s.r. spectroscopy.It has been found that these compounds form stable anion radicals in the absence of oxygen and have half-peak reduction potentials in the same range as the bypyridinium compounds such as paraquat (methyl viologen) or diquat.
