85721-29-5 Usage
General Description
4-allyldecahydro-1a-methyl-3,6-methanonaphth[2,3-b]oxirene is a chemical compound with a complex molecular structure. It consists of a 10-carbon decane ring with an allyl group attached at the fourth carbon and a methyl group at the 1a position. The molecule also contains a unique three-membered oxirane ring fused to a naphthalene backbone, giving it a fused polycyclic structure. 4-allyldecahydro-1a-methyl-3,6-methanonaphth[2,3-b]oxirene may have potential uses as a building block for organic synthesis or as a precursor in the production of other chemical compounds. Its specific properties and potential applications should be further investigated through chemical analysis and testing.
Check Digit Verification of cas no
The CAS Registry Mumber 85721-29-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,7,2 and 1 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 85721-29:
(7*8)+(6*5)+(5*7)+(4*2)+(3*1)+(2*2)+(1*9)=145
145 % 10 = 5
So 85721-29-5 is a valid CAS Registry Number.
InChI:InChI=1/C15H22O/c1-3-4-9-5-10-6-11(9)13-8-15(2)14(16-15)7-12(10)13/h3,9-14H,1,4-8H2,2H3
