857283-96-6 Usage
General Description
[4-(2-Methyl-1,3-thiazol-4-yl)phenyl]methanol is a chemical compound with the molecular formula C11H11NOS. It is an organic compound that contains a thiazole ring and a phenyl group with a methanol functional group attached to the phenyl ring. [4-(2-METHYL-1,3-THIAZOL-4-YL)PHENYL]METHANOL is often used as a building block in the synthesis of pharmaceuticals and agrochemicals. It also has potential applications in organic synthesis and material science due to its unique structural features. The compound may have bioactive properties, making it a subject of interest in drug discovery and development. Overall, [4-(2-Methyl-1,3-thiazol-4-yl)phenyl]methanol is a versatile chemical with various potential applications in the field of chemistry and pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 857283-96-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,7,2,8 and 3 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 857283-96:
(8*8)+(7*5)+(6*7)+(5*2)+(4*8)+(3*3)+(2*9)+(1*6)=216
216 % 10 = 6
So 857283-96-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H11NOS/c1-8-12-11(7-14-8)10-4-2-9(6-13)3-5-10/h2-5,7,13H,6H2,1H3
