858-15-1 Usage
Chemical structure
Consists of a quinoline core with an attached nitro-furylvinyl group and an amino group, and a lactate group attached to the quinoline ring.
Pharmacological properties
Has potential pharmacological properties, making it suitable for the development of antimalarial drugs.
Antimicrobial activity
Known for its antimicrobial activities, which can be useful in treating and preventing infections caused by various microorganisms.
Antiparasitic activity
Possesses antiparasitic properties, which can help combat parasitic infections.
Versatile compound
Due to its multiple properties and potential applications, 2-(5-NITRO-2-FURYLVINYL)-4-AMINO-QUINOLINE-LACTATE is considered a versatile chemical compound.
Medical and pharmaceutical applications
Its potential pharmacological properties, antimicrobial, and antiparasitic activities make it suitable for use in medicine and pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 858-15-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 8,5 and 8 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 858-15:
(5*8)+(4*5)+(3*8)+(2*1)+(1*5)=91
91 % 10 = 1
So 858-15-1 is a valid CAS Registry Number.
InChI:InChI=1/C15H11N3O3.C3H6O3/c16-14-9-10(12-3-1-2-4-13(12)17-14)5-6-11-7-8-15(21-11)18(19)20;1-2(4)3(5)6/h1-9H,(H2,16,17);2,4H,1H3,(H,5,6)/b6-5+;
