85803-92-5 Usage
General Description
Rhizonin A is a natural product derived from the fungus Rhizopus microsporus. It is a cyclodepsipeptide that has demonstrated potent antimicrobial and antifungal activity. Specifically, Rhizonin A has been found to inhibit the growth of various bacteria and fungi, including methicillin-resistant Staphylococcus aureus (MRSA) and Candida albicans. Its mechanism of action involves disrupting the cell membrane of these pathogens, making it a promising candidate for the development of new antimicrobial agents. Additionally, Rhizonin A has also shown potential as an anticancer agent, as it can induce apoptosis in cancer cells. Overall, Rhizonin A has generated significant interest in the scientific community for its diverse biological activities and potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 85803-92-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,5,8,0 and 3 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 85803-92:
(7*8)+(6*5)+(5*8)+(4*0)+(3*3)+(2*9)+(1*2)=155
155 % 10 = 5
So 85803-92-5 is a valid CAS Registry Number.
InChI:InChI=1/C42H65N7O9/c1-13-26(8)35-39(53)44-33(24(4)5)38(52)45-34(25(6)7)42(56)49(12)31(19-28-14-16-57-21-28)36(50)43-30(18-23(2)3)41(55)47(10)27(9)40(54)48(11)32(37(51)46-35)20-29-15-17-58-22-29/h14-17,21-27,30-35H,13,18-20H2,1-12H3,(H,43,50)(H,44,53)(H,45,52)(H,46,51)