858431-29-5 Usage
General Description
2-Amino-3-chloromethyl pyridine is a chemical compound with the molecular formula C6H6ClN2. It is a chlorinated derivative of pyridine, which is an organic compound commonly found in various plant and animal species. This chemical is known for its use in the pharmaceutical industry as a building block for the synthesis of various drugs and pharmaceutical compounds. It is also used in the production of agricultural chemicals and other organic compounds. 2-Amino-3-chloromethyl pyridine is considered to be a hazardous chemical and should be handled with caution due to its potential for causing irritation to the skin, eyes, and respiratory system.
Check Digit Verification of cas no
The CAS Registry Mumber 858431-29-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,8,4,3 and 1 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 858431-29:
(8*8)+(7*5)+(6*8)+(5*4)+(4*3)+(3*1)+(2*2)+(1*9)=195
195 % 10 = 5
So 858431-29-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H7ClN2/c7-4-5-2-1-3-9-6(5)8/h1-3H,4H2,(H2,8,9)
