859155-81-0 Usage
General Description
3-(5-Ethyl-1,2,4-oxadiazol-3-yl)benzoic acid is a chemical compound with the molecular formula C11H10N2O3. It is a derivative of oxadiazole and benzoic acid, and it is commonly used in pharmaceutical and agricultural industries. 3-(5-ETHYL-1,2,4-OXADIAZOL-3-YL)BENZOIC ACID has potential biological and pharmacological activities, and it is studied for its potential therapeutic applications. It exhibits anti-inflammatory, analgesic, and antibacterial properties, making it a valuable candidate for drug development. Additionally, it is also used as an intermediate in the synthesis of various organic compounds. Overall, 3-(5-ethyl-1,2,4-oxadiazol-3-yl)benzoic acid is a versatile chemical with several potential applications in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 859155-81-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,9,1,5 and 5 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 859155-81:
(8*8)+(7*5)+(6*9)+(5*1)+(4*5)+(3*5)+(2*8)+(1*1)=210
210 % 10 = 0
So 859155-81-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N2O3/c1-2-9-12-10(13-16-9)7-4-3-5-8(6-7)11(14)15/h3-6H,2H2,1H3,(H,14,15)
